6-chloro-3-nitrotoluene-2-sulphonic acid

CAS No: 68368-39-8

68368-39-8
68368-33-2 4-(1,1-Dimethylethyl)-N,N-bis(2-hydroxyethyl)benzamide
6837-45-2 3-amino-7-(dimethylamino)-5-(2,4-dimethylphenyl)-1,4-dimethylphenazinium chloride
89227-94-1 Phenol, 2-bromo-4-(2-chloro-1,1,2-trifluoroethoxy)-
683744-75-4 3,4-DIHYDROXY-CYCLOHEXANEETHANESULFONIC ACID
68363-68-8 Furan, 3-[(2-chlorophenyl)methoxy]tetrahydro-
68364-60-3 Benzenesulfonamide,N-[2-cyano-1-(methylthio)-3-oxo-3-phenyl-1-propenyl]-
68363-71-3 Furan, tetrahydro-3-(phenylmethoxy)-
68368-97-8 insulin, Ala(A1)-
68372-12-3 Hydrazinecarbothioamide, N-(4-chloro-2-nitrophenyl)-
6836-36-8 Cyclohexane, 1,4-didecyl-, trans-
68373-95-5 (+)-N-Methyl-3-(5,10,11,11a-tetrahydro-9-hydroxy-11-methoxy-8-methyl-5-oxo-1H-pyrrolo[2,1-c][1,4]benzodiazepine-2-yl)propenamide
68374-33-4 Benzene, 1,1'-[[1,2-bis(methylthio)-1,2-ethenediyl]bis(thio)]bis-, (E)-
68368-50-3 2,2,4-Trimethyl-1,3-pentanediol, isophthalic acid, adipic acid polymer
68373-93-3 3-(5,11a-Dihydro-9-hydroxy-8-methyl-5-oxo-1H-pyrrolo[2,1-c][1,4]benzodiazepine-2-yl)-N-methylpropenamide
68374-35-6 (R)-(+)-Pindolol
68373-65-9 3-pyridinecarboxamide, 1,2-dihydro-4-hydroxy-6-methyl-2-oxo-
68368-82-1 Unique Gum M 7010
68366-01-8 cyclopenta-1,3-diene
68368-39-8 6-chloro-3-nitrotoluene-2-sulphonic acid
68362-57-2 OXIRANECARBOXYLIC ACID 3-(CHLOROCARBONYL)-,ETHYL ESTER
68368-39-8 chloro,nitrotoluene,sulphonic,68368-39-8
2025-10-17 Discover 6-chloro-3-nitrotoluene-2-sulphonic acid (CAS No: 68368-39-8) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.